About 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one
3-cycloheptyloxy-2,2-diethylcyclobutan-1-one (PubChem CID 66367250) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one.
Molecular Properties
| Compound Name | 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one |
| PubChem CID | 66367250 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one |
| SMILES | CCC1(CC)C(=O)CC1OC1CCCCCC1 |
| InChI | InChI=1S/C15H26O2/c1-3-15(4-2)13(16)11-14(15)17-12-9-7-5-6-8-10-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | BCYVMLJCKACHHL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one?
The IUPAC name of 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one (CID 66367250) is 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one.
What is the SMILES notation for 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one?
The canonical SMILES for 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one is CCC1(CC)C(=O)CC1OC1CCCCCC1.
What is the InChIKey of 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one?
The InChIKey is BCYVMLJCKACHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-3-15(4-2)13(16)11-14(15)17-12-9-7-5-6-8-10-12/h12,14H,3-11H2,1-2H3.
What are the key properties of 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one?
3-cycloheptyloxy-2,2-diethylcyclobutan-1-one has a molecular weight of 238.37 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyloxy-2,2-diethylcyclobutan-1-one is sourced from PubChem (CID 66367250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).