C9H9ClF3N3O2 — CID 66367372
4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde (PubChem CID 66367372) has the molecular formula C9H9ClF3N3O2 and a molecular weight of 283.64 g/mol. Its IUPAC name is 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 66367372 |
| Molecular Formula | C9H9ClF3N3O2 |
| Molecular Weight | 283.64 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(Cl)ncnc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N3O2/c10-7-6(3-17)8(16-5-15-7)14-1-2-18-4-9(11,12)13/h3,5H,1-2,4H2,(H,14,15,16) |
| InChIKey | GAJDTDVDDKOZQD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|