C23H33N3O3 — CID 6636858
[(2R,3S,6R)-3-[4-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)butan-2-ylideneamino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 6636858) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is [(2R,3S,6R)-3-[4-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)butan-2-ylideneamino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,3S,6R)-3-[4-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)butan-2-ylideneamino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 6636858 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | [(2R,3S,6R)-3-[4-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)butan-2-ylideneamino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | C=CC[C@@H]1C=C[C@H](ON=C(C)CCN2CCCc3nc(C)c(C)cc32)[C@@H](CO)O1 |
| InChI | InChI=1S/C23H33N3O3/c1-5-7-19-9-10-22(23(15-27)28-19)29-25-17(3)11-13-26-12-6-8-20-21(26)14-16(2)18(4)24-20/h5,9-10,14,19,22-23,27H,1,6-8,11-13,15H2,2-4H3/t19-,22+,23-/m1/s1 |
| InChIKey | ZNDLMMWGIFFBCM-WTIAFYNJSA-N |
| XLogP | 3.49 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|