C37H41N3O5 — CID 6636960
methyl (2S,5S,6S)-5-methyl-6-(4-methylphenyl)-1-[4-[[(1S)-1-[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]ethoxy]iminomethyl]benzoyl]piperidine-2-carboxylate (PubChem CID 6636960) has the molecular formula C37H41N3O5 and a molecular weight of 607.75 g/mol. Its IUPAC name is methyl (2S,5S,6S)-5-methyl-6-(4-methylphenyl)-1-[4-[[(1S)-1-[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]ethoxy]iminomethyl]benzoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S,5S,6S)-5-methyl-6-(4-methylphenyl)-1-[4-[[(1S)-1-[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]ethoxy]iminomethyl]benzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 6636960 |
| Molecular Formula | C37H41N3O5 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | methyl (2S,5S,6S)-5-methyl-6-(4-methylphenyl)-1-[4-[[(1S)-1-[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]ethoxy]iminomethyl]benzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](C)[C@@H](c2ccc(C)cc2)N1C(=O)c1ccc(C=NO[C@@H](C)c2cc(-c3c(C)cc(C)cc3C)no2)cc1 |
| InChI | InChI=1S/C37H41N3O5/c1-22-8-13-29(14-9-22)35-24(3)10-17-32(37(42)43-7)40(35)36(41)30-15-11-28(12-16-30)21-38-44-27(6)33-20-31(39-45-33)34-25(4)18-23(2)19-26(34)5/h8-9,11-16,18-21,24,27,32,35H,10,17H2,1-7H3/t24-,27-,32-,35-/m0/s1 |
| InChIKey | CGGDWQNRIQZDRC-IFDYZIMZSA-N |
| XLogP | 7.84 |
| TPSA | 94.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|