About 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane
3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 66369971) has the molecular formula C9H13BrF3NO
and a molecular weight of 288.11 g/mol. Its IUPAC name is 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane |
| PubChem CID | 66369971 |
| Molecular Formula | C9H13BrF3NO |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)C(Br)CN1CC2CCC(C1)O2 |
| InChI | InChI=1S/C9H13BrF3NO/c10-8(9(11,12)13)5-14-3-6-1-2-7(4-14)15-6/h6-8H,1-5H2 |
| InChIKey | PTKFNJJDTUHQSJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane?
The IUPAC name of 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane (CID 66369971) is 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane.
What is the SMILES notation for 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane?
The canonical SMILES for 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane is FC(F)(F)C(Br)CN1CC2CCC(C1)O2.
What is the InChIKey of 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane?
The InChIKey is PTKFNJJDTUHQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrF3NO/c10-8(9(11,12)13)5-14-3-6-1-2-7(4-14)15-6/h6-8H,1-5H2.
What are the key properties of 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane?
3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane has a molecular weight of 288.11 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-3,3,3-trifluoropropyl)-8-oxa-3-azabicyclo[3.2.1]octane is sourced from PubChem (CID 66369971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).