C14H21N3O — CID 66370631
2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 66370631) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 66370631 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | c1ccc(CNCCN2CC3CCC(C2)O3)nc1 |
| InChI | InChI=1S/C14H21N3O/c1-2-6-16-12(3-1)9-15-7-8-17-10-13-4-5-14(11-17)18-13/h1-3,6,13-15H,4-5,7-11H2 |
| InChIKey | UROWTYBAYNUMDU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|