C12H22N2O3 — CID 66370778
3-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-2-(propan-2-ylamino)propanoic acid (PubChem CID 66370778) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-2-(propan-2-ylamino)propanoic acid.
| Compound Name | 3-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66370778 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-2-(propan-2-ylamino)propanoic acid |
| SMILES | CC(C)NC(CN1CC2CCC(C1)O2)C(=O)O |
| InChI | InChI=1S/C12H22N2O3/c1-8(2)13-11(12(15)16)7-14-5-9-3-4-10(6-14)17-9/h8-11,13H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | KXSZIEDKVMYKIT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |