C11H13F3N2O4S — CID 66372493
2-[1-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66372493) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-[1-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66372493 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[1-[3-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NC(=O)CCOCC(F)(F)F)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H13F3N2O4S/c1-6(9-16-7(4-21-9)10(18)19)15-8(17)2-3-20-5-11(12,13)14/h4,6H,2-3,5H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | UKVVXAHYPZUAQZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|