About 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid
2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66372600) has the molecular formula C10H9N5O4S
and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 66372600 |
| Molecular Formula | C10H9N5O4S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(Nc1ncc([N+](=O)[O-])cn1)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H9N5O4S/c1-5(8-14-7(4-20-8)9(16)17)13-10-11-2-6(3-12-10)15(18)19/h2-5H,1H3,(H,16,17)(H,11,12,13) |
| InChIKey | HAUBYEUNADYNIU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (CID 66372600) is 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid is CC(Nc1ncc([N+](=O)[O-])cn1)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is HAUBYEUNADYNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O4S/c1-5(8-14-7(4-20-8)9(16)17)13-10-11-2-6(3-12-10)15(18)19/h2-5H,1H3,(H,16,17)(H,11,12,13).
What are the key properties of 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 295.28 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(5-nitropyrimidin-2-yl)amino]ethyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 66372600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).