C13H11ClN2O3S — CID 66373281
2-[2-[(4-chlorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66373281) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is 2-[2-[(4-chlorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(4-chlorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66373281 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[2-[(4-chlorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCc1nc(C(=O)O)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClN2O3S/c14-9-3-1-8(2-4-9)12(17)15-6-5-11-16-10(7-20-11)13(18)19/h1-4,7H,5-6H2,(H,15,17)(H,18,19) |
| InChIKey | ADKUHAMKEVDKOZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |