C13H20N4O3S — CID 66374308
2-[1-[3-(cyclopropylamino)propylcarbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66374308) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-[1-[3-(cyclopropylamino)propylcarbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[3-(cyclopropylamino)propylcarbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66374308 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[1-[3-(cyclopropylamino)propylcarbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NC(=O)NCCCNC1CC1)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H20N4O3S/c1-8(11-17-10(7-21-11)12(18)19)16-13(20)15-6-2-5-14-9-3-4-9/h7-9,14H,2-6H2,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | KFGJBOKHRZDTCP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|