C23H26O4 — CID 6637630
(4aR,8R,8aS)-7-ethenyl-8-(3-ethoxy-2-hydroxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6637630) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4aR,8R,8aS)-7-ethenyl-8-(3-ethoxy-2-hydroxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aR,8R,8aS)-7-ethenyl-8-(3-ethoxy-2-hydroxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637630 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (4aR,8R,8aS)-7-ethenyl-8-(3-ethoxy-2-hydroxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C(C)=C(C)C(=O)[C@@]2(C)[C@H]1c1cccc(OCC)c1O |
| InChI | InChI=1S/C23H26O4/c1-6-15-11-12-17-20(24)13(3)14(4)22(26)23(17,5)19(15)16-9-8-10-18(21(16)25)27-7-2/h6,8-11,17,19,25H,1,7,12H2,2-5H3/t17-,19+,23+/m0/s1 |
| InChIKey | REAHMZZSNJGILF-GEQKSPFYSA-N |
| XLogP | 4.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |