About 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol
3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 66376546) has the molecular formula C9H16F3NO3S2
and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 66376546 |
| Molecular Formula | C9H16F3NO3S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCS(=O)(=O)C1CSCCN1CC(O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3S2/c1-2-18(15,16)8-6-17-4-3-13(8)5-7(14)9(10,11)12/h7-8,14H,2-6H2,1H3 |
| InChIKey | QNAFGISAXSJHTI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol (CID 66376546) is 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol is CCS(=O)(=O)C1CSCCN1CC(O)C(F)(F)F.
What is the InChIKey of 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol?
The InChIKey is QNAFGISAXSJHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3S2/c1-2-18(15,16)8-6-17-4-3-13(8)5-7(14)9(10,11)12/h7-8,14H,2-6H2,1H3.
What are the key properties of 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol?
3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol has a molecular weight of 307.36 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylsulfonylthiomorpholin-4-yl)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 66376546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).