C14H12N6 — CID 663772
5-ethyl-10-phenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 663772) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-ethyl-10-phenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 5-ethyl-10-phenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 663772 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-ethyl-10-phenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1nnc2c3cnn(-c4ccccc4)c3ncn12 |
| InChI | InChI=1S/C14H12N6/c1-2-12-17-18-14-11-8-16-20(10-6-4-3-5-7-10)13(11)15-9-19(12)14/h3-9H,2H2,1H3 |
| InChIKey | XONRNCRBGDQGQO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |