C18H12Cl4O3 — CID 6637724
(4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione (PubChem CID 6637724) has the molecular formula C18H12Cl4O3 and a molecular weight of 418.10 g/mol. Its IUPAC name is (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637724 |
| Molecular Formula | C18H12Cl4O3 |
| Molecular Weight | 418.10 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)C(Cl)=C(Cl)C(=O)[C@@]2(Cl)[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H12Cl4O3/c1-2-9-7-8-17(21)15(24)13(19)14(20)16(25)18(17,22)12(9)10-3-5-11(23)6-4-10/h2-7,12,23H,1,8H2/t12-,17-,18+/m1/s1 |
| InChIKey | SYKJFSHLDJVCPU-PJSAGSTRSA-N |
| XLogP | 4.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.10 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|