C20H16Cl4O4 — CID 6637730
(4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-ethoxy-4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione (PubChem CID 6637730) has the molecular formula C20H16Cl4O4 and a molecular weight of 462.16 g/mol. Its IUPAC name is (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-ethoxy-4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-ethoxy-4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637730 |
| Molecular Formula | C20H16Cl4O4 |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | (4aS,5R,8aR)-2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-ethoxy-4-hydroxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)C(Cl)=C(Cl)C(=O)[C@@]2(Cl)[C@H]1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C20H16Cl4O4/c1-3-10-7-8-19(23)17(26)15(21)16(22)18(27)20(19,24)14(10)11-5-6-12(25)13(9-11)28-4-2/h3,5-7,9,14,25H,1,4,8H2,2H3/t14-,19-,20+/m1/s1 |
| InChIKey | HVVGCHOHTBUNOR-XMCHAPAWSA-N |
| XLogP | 5.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|