C10H10N4OS — CID 66377402
2-(aminomethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 66377402) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(aminomethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66377402 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(aminomethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2ccccn2)cs1 |
| InChI | InChI=1S/C10H10N4OS/c11-5-9-13-7(6-16-9)10(15)14-8-3-1-2-4-12-8/h1-4,6H,5,11H2,(H,12,14,15) |
| InChIKey | QFMUOGDYKDRQKN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |