C20H27N3O3 — CID 663776
2-(hexylamino)-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 663776) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(hexylamino)-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-(hexylamino)-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 663776 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-(hexylamino)-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | CCCCCCNc1cc2n(c(=O)n1)CCc1cc(OC)c(OC)cc1-2 |
| InChI | InChI=1S/C20H27N3O3/c1-4-5-6-7-9-21-19-13-16-15-12-18(26-3)17(25-2)11-14(15)8-10-23(16)20(24)22-19/h11-13H,4-10H2,1-3H3,(H,21,22,24) |
| InChIKey | OPSKQPYXZASNGA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|