About 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine
1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine (PubChem CID 66377767) has the molecular formula C11H24N2O2S2
and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine |
| PubChem CID | 66377767 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine |
| SMILES | CCS(=O)(=O)C1CSCCN1CC(C)(C)NC |
| InChI | InChI=1S/C11H24N2O2S2/c1-5-17(14,15)10-8-16-7-6-13(10)9-11(2,3)12-4/h10,12H,5-9H2,1-4H3 |
| InChIKey | BPXGMWGXIPAYKF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine?
The IUPAC name of 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine (CID 66377767) is 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine.
What is the SMILES notation for 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine?
The canonical SMILES for 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine is CCS(=O)(=O)C1CSCCN1CC(C)(C)NC.
What is the InChIKey of 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine?
The InChIKey is BPXGMWGXIPAYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2S2/c1-5-17(14,15)10-8-16-7-6-13(10)9-11(2,3)12-4/h10,12H,5-9H2,1-4H3.
What are the key properties of 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine?
1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine has a molecular weight of 280.46 g/mol, XLogP of 0.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylsulfonylthiomorpholin-4-yl)-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 66377767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).