C10H14N4O2S — CID 66381108
[4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-yl]methanamine (PubChem CID 66381108) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is [4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-yl]methanamine.
| Compound Name | [4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 66381108 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-yl]methanamine |
| SMILES | COCCCc1noc(-c2csc(CN)n2)n1 |
| InChI | InChI=1S/C10H14N4O2S/c1-15-4-2-3-8-13-10(16-14-8)7-6-17-9(5-11)12-7/h6H,2-5,11H2,1H3 |
| InChIKey | YAZQAPUEZDITOH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|