About tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate
tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate (PubChem CID 66381496) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 66381496 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-9(2,3)13-8(12)6-5-14-7(4-10)11-6/h5H,4,10H2,1-3H3 |
| InChIKey | UBLMADIZVCGVFU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate (CID 66381496) is tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate is CC(C)(C)OC(=O)c1csc(CN)n1.
What is the InChIKey of tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate?
The InChIKey is UBLMADIZVCGVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-9(2,3)13-8(12)6-5-14-7(4-10)11-6/h5H,4,10H2,1-3H3.
What are the key properties of tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate?
tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate has a molecular weight of 214.29 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 66381496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).