C10H21N3O3S2 — CID 66381881
4-(3-methylsulfonylthiomorpholin-4-yl)pentanehydrazide (PubChem CID 66381881) has the molecular formula C10H21N3O3S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)pentanehydrazide.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)pentanehydrazide |
|---|---|
| PubChem CID | 66381881 |
| Molecular Formula | C10H21N3O3S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C10H21N3O3S2/c1-8(3-4-9(14)12-11)13-5-6-17-7-10(13)18(2,15)16/h8,10H,3-7,11H2,1-2H3,(H,12,14) |
| InChIKey | WFYCGVUYFCJETP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|