C9H19N3O2S2 — CID 66382008
2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanimidamide (PubChem CID 66382008) has the molecular formula C9H19N3O2S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanimidamide.
| Compound Name | 2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanimidamide |
|---|---|
| PubChem CID | 66382008 |
| Molecular Formula | C9H19N3O2S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C9H19N3O2S2/c1-7(9(10)11)5-12-3-4-15-6-8(12)16(2,13)14/h7-8H,3-6H2,1-2H3,(H3,10,11) |
| InChIKey | OESWNQRHOJNKHS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|