C13H19N3O3S2 — CID 66382662
3-[(3-methylsulfonylthiomorpholin-4-yl)methyl]benzohydrazide (PubChem CID 66382662) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-[(3-methylsulfonylthiomorpholin-4-yl)methyl]benzohydrazide.
| Compound Name | 3-[(3-methylsulfonylthiomorpholin-4-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 66382662 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[(3-methylsulfonylthiomorpholin-4-yl)methyl]benzohydrazide |
| SMILES | CS(=O)(=O)C1CSCCN1Cc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C13H19N3O3S2/c1-21(18,19)12-9-20-6-5-16(12)8-10-3-2-4-11(7-10)13(17)15-14/h2-4,7,12H,5-6,8-9,14H2,1H3,(H,15,17) |
| InChIKey | BQYDFRUKDFSDFN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|