About 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine (PubChem CID 66382849) has the molecular formula C8H11ClN2O4S4
and a molecular weight of 362.91 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine.
Molecular Properties
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine |
| PubChem CID | 66382849 |
| Molecular Formula | C8H11ClN2O4S4 |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C8H11ClN2O4S4/c1-18(12,13)6-5-16-3-2-11(6)19(14,15)7-4-10-8(9)17-7/h4,6H,2-3,5H2,1H3 |
| InChIKey | QDXCBBOQCUUICK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine?
The IUPAC name of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine (CID 66382849) is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine.
What is the SMILES notation for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine?
The canonical SMILES for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine is CS(=O)(=O)C1CSCCN1S(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine?
The InChIKey is QDXCBBOQCUUICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O4S4/c1-18(12,13)6-5-16-3-2-11(6)19(14,15)7-4-10-8(9)17-7/h4,6H,2-3,5H2,1H3.
What are the key properties of 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine?
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine has a molecular weight of 362.91 g/mol, XLogP of 0.90, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-3-methylsulfonylthiomorpholine is sourced from PubChem (CID 66382849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).