About 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine
4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine (PubChem CID 66383008) has the molecular formula C8H13BrF3NO2S2
and a molecular weight of 356.23 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine.
Molecular Properties
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine |
| PubChem CID | 66383008 |
| Molecular Formula | C8H13BrF3NO2S2 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1CC(Br)C(F)(F)F |
| InChI | InChI=1S/C8H13BrF3NO2S2/c1-17(14,15)7-5-16-3-2-13(7)4-6(9)8(10,11)12/h6-7H,2-5H2,1H3 |
| InChIKey | PPYCPKTXLXPPFE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine?
The IUPAC name of 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine (CID 66383008) is 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine.
What is the SMILES notation for 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine?
The canonical SMILES for 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine is CS(=O)(=O)C1CSCCN1CC(Br)C(F)(F)F.
What is the InChIKey of 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine?
The InChIKey is PPYCPKTXLXPPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrF3NO2S2/c1-17(14,15)7-5-16-3-2-13(7)4-6(9)8(10,11)12/h6-7H,2-5H2,1H3.
What are the key properties of 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine?
4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine has a molecular weight of 356.23 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromo-3,3,3-trifluoropropyl)-3-methylsulfonylthiomorpholine is sourced from PubChem (CID 66383008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).