C13H19FN2O2S2 — CID 66383947
(1S)-1-[2-fluoro-6-(3-methylsulfonylthiomorpholin-4-yl)phenyl]ethanamine (PubChem CID 66383947) has the molecular formula C13H19FN2O2S2 and a molecular weight of 318.44 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-6-(3-methylsulfonylthiomorpholin-4-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[2-fluoro-6-(3-methylsulfonylthiomorpholin-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 66383947 |
| Molecular Formula | C13H19FN2O2S2 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (1S)-1-[2-fluoro-6-(3-methylsulfonylthiomorpholin-4-yl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1c(F)cccc1N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C13H19FN2O2S2/c1-9(15)13-10(14)4-3-5-11(13)16-6-7-19-8-12(16)20(2,17)18/h3-5,9,12H,6-8,15H2,1-2H3/t9-,12?/m0/s1 |
| InChIKey | ZARWZVJHVBCLBW-QHGLUPRGSA-N |
| XLogP | 1.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |