C13H22N2O2S — CID 66385194
N-[2-[[3-(hydroxymethyl)pentan-3-ylamino]methyl]thiophen-3-yl]acetamide (PubChem CID 66385194) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-[2-[[3-(hydroxymethyl)pentan-3-ylamino]methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[[3-(hydroxymethyl)pentan-3-ylamino]methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 66385194 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[2-[[3-(hydroxymethyl)pentan-3-ylamino]methyl]thiophen-3-yl]acetamide |
| SMILES | CCC(CC)(CO)NCc1sccc1NC(C)=O |
| InChI | InChI=1S/C13H22N2O2S/c1-4-13(5-2,9-16)14-8-12-11(6-7-18-12)15-10(3)17/h6-7,14,16H,4-5,8-9H2,1-3H3,(H,15,17) |
| InChIKey | DOJXOMJRGZDIBD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |