About 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine
2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine (PubChem CID 66385569) has the molecular formula C13H19F3N2OS
and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine.
Molecular Properties
| Compound Name | 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine |
| PubChem CID | 66385569 |
| Molecular Formula | C13H19F3N2OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine |
| SMILES | Nc1ccsc1CNC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H19F3N2OS/c14-13(15,16)8-19-10-3-1-2-9(6-10)18-7-12-11(17)4-5-20-12/h4-5,9-10,18H,1-3,6-8,17H2 |
| InChIKey | SOAKCKSYQGSWRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine?
The IUPAC name of 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine (CID 66385569) is 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine.
What is the SMILES notation for 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine?
The canonical SMILES for 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine is Nc1ccsc1CNC1CCCC(OCC(F)(F)F)C1.
What is the InChIKey of 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine?
The InChIKey is SOAKCKSYQGSWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2OS/c14-13(15,16)8-19-10-3-1-2-9(6-10)18-7-12-11(17)4-5-20-12/h4-5,9-10,18H,1-3,6-8,17H2.
What are the key properties of 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine?
2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine has a molecular weight of 308.37 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[3-(2,2,2-trifluoroethoxy)cyclohexyl]amino]methyl]thiophen-3-amine is sourced from PubChem (CID 66385569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).