About 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine
2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine (PubChem CID 66385925) has the molecular formula C11H9Br3N2S
and a molecular weight of 440.99 g/mol. Its IUPAC name is 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine.
Molecular Properties
| Compound Name | 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine |
| PubChem CID | 66385925 |
| Molecular Formula | C11H9Br3N2S |
| Molecular Weight | 440.99 g/mol |
| Exact Mass | 437.80 |
| IUPAC Name | 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine |
| SMILES | Nc1ccsc1CNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H9Br3N2S/c12-6-3-7(13)11(8(14)4-6)16-5-10-9(15)1-2-17-10/h1-4,16H,5,15H2 |
| InChIKey | FIDAUNPTJVAASK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine?
The IUPAC name of 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine (CID 66385925) is 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine.
What is the SMILES notation for 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine?
The canonical SMILES for 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine is Nc1ccsc1CNc1c(Br)cc(Br)cc1Br.
What is the InChIKey of 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine?
The InChIKey is FIDAUNPTJVAASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br3N2S/c12-6-3-7(13)11(8(14)4-6)16-5-10-9(15)1-2-17-10/h1-4,16H,5,15H2.
What are the key properties of 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine?
2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine has a molecular weight of 440.99 g/mol, XLogP of 5.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4,6-tribromoanilino)methyl]thiophen-3-amine is sourced from PubChem (CID 66385925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).