About N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide
N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide (PubChem CID 66386020) has the molecular formula C13H11F3N2OS
and a molecular weight of 300.31 g/mol. Its IUPAC name is N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide |
| PubChem CID | 66386020 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H11F3N2OS/c1-7(19)18-11-2-3-20-12(11)6-17-13-9(15)4-8(14)5-10(13)16/h2-5,17H,6H2,1H3,(H,18,19) |
| InChIKey | SXCFZPWOQCJOHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide?
The IUPAC name of N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide (CID 66386020) is N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide.
What is the SMILES notation for N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide?
The canonical SMILES for N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide is CC(=O)Nc1ccsc1CNc1c(F)cc(F)cc1F.
What is the InChIKey of N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide?
The InChIKey is SXCFZPWOQCJOHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2OS/c1-7(19)18-11-2-3-20-12(11)6-17-13-9(15)4-8(14)5-10(13)16/h2-5,17H,6H2,1H3,(H,18,19).
What are the key properties of N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide?
N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide has a molecular weight of 300.31 g/mol, XLogP of 3.74, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,4,6-trifluoroanilino)methyl]thiophen-3-yl]acetamide is sourced from PubChem (CID 66386020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).