C15H23N3OS — CID 66387368
N-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]thiophen-3-yl]acetamide (PubChem CID 66387368) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 66387368 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C15H23N3OS/c1-11(19)17-14-6-9-20-15(14)10-16-12-4-7-18(8-5-12)13-2-3-13/h6,9,12-13,16H,2-5,7-8,10H2,1H3,(H,17,19) |
| InChIKey | ADFVWRGLMOKUMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |