C11H18N2O3S2 — CID 66387613
N-[2-[(1-methylsulfonylpropan-2-ylamino)methyl]thiophen-3-yl]acetamide (PubChem CID 66387613) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[2-[(1-methylsulfonylpropan-2-ylamino)methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[(1-methylsulfonylpropan-2-ylamino)methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 66387613 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[2-[(1-methylsulfonylpropan-2-ylamino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O3S2/c1-8(7-18(3,15)16)12-6-11-10(4-5-17-11)13-9(2)14/h4-5,8,12H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | QYDPCJSEWCDFNE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |