C17H18N2O — CID 66387855
2-[[1-(1-benzofuran-2-yl)ethylamino]methyl]aniline (PubChem CID 66387855) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[[1-(1-benzofuran-2-yl)ethylamino]methyl]aniline.
| Compound Name | 2-[[1-(1-benzofuran-2-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 66387855 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[[1-(1-benzofuran-2-yl)ethylamino]methyl]aniline |
| SMILES | CC(NCc1ccccc1N)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H18N2O/c1-12(19-11-14-7-2-4-8-15(14)18)17-10-13-6-3-5-9-16(13)20-17/h2-10,12,19H,11,18H2,1H3 |
| InChIKey | APAOWLJMDHQLHN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|