C13H23N3S — CID 66387988
2-[[(1-ethylpiperidin-4-yl)methylamino]methyl]thiophen-3-amine (PubChem CID 66387988) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-[[(1-ethylpiperidin-4-yl)methylamino]methyl]thiophen-3-amine.
| Compound Name | 2-[[(1-ethylpiperidin-4-yl)methylamino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66387988 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[[(1-ethylpiperidin-4-yl)methylamino]methyl]thiophen-3-amine |
| SMILES | CCN1CCC(CNCc2sccc2N)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-2-16-6-3-11(4-7-16)9-15-10-13-12(14)5-8-17-13/h5,8,11,15H,2-4,6-7,9-10,14H2,1H3 |
| InChIKey | OFVZQDFFBNCPAD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |