C12H9N3O2S — CID 663880
furan-2-yl-(5-methyl-2-sulfanylidene-[1,2,4]triazolo[1,5-a]pyridin-3-yl)methanone (PubChem CID 663880) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is furan-2-yl-(5-methyl-2-sulfanylidene-[1,2,4]triazolo[1,5-a]pyridin-3-yl)methanone.
| Compound Name | furan-2-yl-(5-methyl-2-sulfanylidene-[1,2,4]triazolo[1,5-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 663880 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | furan-2-yl-(5-methyl-2-sulfanylidene-[1,2,4]triazolo[1,5-a]pyridin-3-yl)methanone |
| SMILES | Cc1cccc2nc(=S)n(C(=O)c3ccco3)n12 |
| InChI | InChI=1S/C12H9N3O2S/c1-8-4-2-6-10-13-12(18)15(14(8)10)11(16)9-5-3-7-17-9/h2-7H,1H3 |
| InChIKey | DZKXHZLHRCIBHX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|