C15H20FN3O2 — CID 66391278
N-(5-amino-2-fluorophenyl)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)propanamide (PubChem CID 66391278) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
|---|---|
| PubChem CID | 66391278 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
| SMILES | CC(C(=O)Nc1cc(N)ccc1F)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C15H20FN3O2/c1-9(19-7-11-3-4-12(8-19)21-11)15(20)18-14-6-10(17)2-5-13(14)16/h2,5-6,9,11-12H,3-4,7-8,17H2,1H3,(H,18,20) |
| InChIKey | DQUYGLWTEZVGPR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|