C16H22N4O — CID 66391531
2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide (PubChem CID 66391531) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide.
| Compound Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
|---|---|
| PubChem CID | 66391531 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(nc1N1CC3CCC(C1)O3)CCCC2 |
| InChI | InChI=1S/C16H22N4O/c17-15(18)13-7-10-3-1-2-4-14(10)19-16(13)20-8-11-5-6-12(9-20)21-11/h7,11-12H,1-6,8-9H2,(H3,17,18) |
| InChIKey | BKPVEDOKYRBEIO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|