C13H14N2O3 — CID 66391953
1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 66391953) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66391953 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)CC(CN1CC(=O)NC1=O)O2 |
| InChI | InChI=1S/C13H14N2O3/c1-8-2-3-11-9(4-8)5-10(18-11)6-15-7-12(16)14-13(15)17/h2-4,10H,5-7H2,1H3,(H,14,16,17) |
| InChIKey | XILDTBLGUJWGJO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|