C28H22N6O5 — CID 6639318
(1S,10S)-10-(4-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639318) has the molecular formula C28H22N6O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is (1S,10S)-10-(4-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1S,10S)-10-(4-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639318 |
| Molecular Formula | C28H22N6O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (1S,10S)-10-(4-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1CC=C1[C@H]2Cn2c(=O)n(-c3ccccc3)c(=O)n2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C28H22N6O5/c35-21-13-11-18(12-14-21)24-22-15-16-29-25(36)31(19-7-3-1-4-8-19)27(38)33(29)23(22)17-30-26(37)32(28(39)34(24)30)20-9-5-2-6-10-20/h1-15,23-24,35H,16-17H2/t23-,24+/m1/s1 |
| InChIKey | MYKVGDWKOCFSCX-RPWUZVMVSA-N |
| XLogP | 1.40 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|