C18H17FN6O5 — CID 6639320
(1S,10S)-10-(3-fluoro-4-hydroxyphenyl)-4,13-dimethyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639320) has the molecular formula C18H17FN6O5 and a molecular weight of 416.37 g/mol. Its IUPAC name is (1S,10S)-10-(3-fluoro-4-hydroxyphenyl)-4,13-dimethyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1S,10S)-10-(3-fluoro-4-hydroxyphenyl)-4,13-dimethyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639320 |
| Molecular Formula | C18H17FN6O5 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (1S,10S)-10-(3-fluoro-4-hydroxyphenyl)-4,13-dimethyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1Cn3c(=O)n(C)c(=O)n3[C@@H](c3ccc(O)c(F)c3)C1=CC2 |
| InChI | InChI=1S/C18H17FN6O5/c1-20-15(27)22-6-5-10-12(24(22)17(20)29)8-23-16(28)21(2)18(30)25(23)14(10)9-3-4-13(26)11(19)7-9/h3-5,7,12,14,26H,6,8H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | BABDLKCVSVGRAM-OCCSQVGLSA-N |
| XLogP | -1.36 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|