C14H15BrN2O3 — CID 66393201
3-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]piperidine-2,6-dione (PubChem CID 66393201) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 3-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]piperidine-2,6-dione.
| Compound Name | 3-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 66393201 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylamino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NCC2Cc3cc(Br)ccc3O2)C(=O)N1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-9-1-3-12-8(5-9)6-10(20-12)7-16-11-2-4-13(18)17-14(11)19/h1,3,5,10-11,16H,2,4,6-7H2,(H,17,18,19) |
| InChIKey | KOEQSRDVNOJFGX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|