About N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine
N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine (PubChem CID 66393308) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine |
| PubChem CID | 66393308 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine |
| SMILES | CCNCCCCC1Cc2cc(C)ccc2O1 |
| InChI | InChI=1S/C15H23NO/c1-3-16-9-5-4-6-14-11-13-10-12(2)7-8-15(13)17-14/h7-8,10,14,16H,3-6,9,11H2,1-2H3 |
| InChIKey | JCWPAMSJAXQXMT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine?
The IUPAC name of N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine (CID 66393308) is N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine.
What is the SMILES notation for N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine?
The canonical SMILES for N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine is CCNCCCCC1Cc2cc(C)ccc2O1.
What is the InChIKey of N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine?
The InChIKey is JCWPAMSJAXQXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-3-16-9-5-4-6-14-11-13-10-12(2)7-8-15(13)17-14/h7-8,10,14,16H,3-6,9,11H2,1-2H3.
What are the key properties of N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine?
N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine has a molecular weight of 233.35 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)butan-1-amine is sourced from PubChem (CID 66393308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).