About 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one
5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one (PubChem CID 66393969) has the molecular formula C15H19ClN2O2
and a molecular weight of 294.78 g/mol. Its IUPAC name is 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one |
| PubChem CID | 66393969 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one |
| SMILES | CN1CC(NCC2Cc3cc(Cl)ccc3O2)CCC1=O |
| InChI | InChI=1S/C15H19ClN2O2/c1-18-9-12(3-5-15(18)19)17-8-13-7-10-6-11(16)2-4-14(10)20-13/h2,4,6,12-13,17H,3,5,7-9H2,1H3 |
| InChIKey | SYQUCQUTVAQRNF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one (CID 66393969) is 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one is CN1CC(NCC2Cc3cc(Cl)ccc3O2)CCC1=O.
What is the InChIKey of 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one?
The InChIKey is SYQUCQUTVAQRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O2/c1-18-9-12(3-5-15(18)19)17-8-13-7-10-6-11(16)2-4-14(10)20-13/h2,4,6,12-13,17H,3,5,7-9H2,1H3.
What are the key properties of 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one?
5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one has a molecular weight of 294.78 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-1-methylpiperidin-2-one is sourced from PubChem (CID 66393969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).