C16H20N2O2 — CID 66394453
2-[5-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 66394453) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[5-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[5-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 66394453 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[5-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCc1ncc(C2Cc3ccccc32)o1 |
| InChI | InChI=1S/C16H20N2O2/c1-19-9-8-17-7-6-16-18-11-15(20-16)14-10-12-4-2-3-5-13(12)14/h2-5,11,14,17H,6-10H2,1H3 |
| InChIKey | BEUIQUCBYHMQMJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|