About (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone
(4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone (PubChem CID 66395210) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone.
Molecular Properties
| Compound Name | (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone |
| PubChem CID | 66395210 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone |
| SMILES | Cc1cc(C(=O)C2Cc3ccccc32)ccc1N |
| InChI | InChI=1S/C16H15NO/c1-10-8-12(6-7-15(10)17)16(18)14-9-11-4-2-3-5-13(11)14/h2-8,14H,9,17H2,1H3 |
| InChIKey | XXSKSUFYZMPFQG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone?
The IUPAC name of (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone (CID 66395210) is (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone.
What is the SMILES notation for (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone?
The canonical SMILES for (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone is Cc1cc(C(=O)C2Cc3ccccc32)ccc1N.
What is the InChIKey of (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone?
The InChIKey is XXSKSUFYZMPFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-10-8-12(6-7-15(10)17)16(18)14-9-11-4-2-3-5-13(11)14/h2-8,14H,9,17H2,1H3.
What are the key properties of (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone?
(4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone has a molecular weight of 237.30 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3-methylphenyl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone is sourced from PubChem (CID 66395210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).