C15H13F2NO2S — CID 66396037
4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-3,5-difluoroaniline (PubChem CID 66396037) has the molecular formula C15H13F2NO2S and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-3,5-difluoroaniline.
| Compound Name | 4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 66396037 |
| Molecular Formula | C15H13F2NO2S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(S(=O)(=O)CC2Cc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C15H13F2NO2S/c16-13-6-11(18)7-14(17)15(13)21(19,20)8-10-5-9-3-1-2-4-12(9)10/h1-4,6-7,10H,5,8,18H2 |
| InChIKey | RIQAKMZPGRDAJT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|