C11H18N2O — CID 66397450
N-[(1-methylpyrrol-3-yl)methyl]oxan-4-amine (PubChem CID 66397450) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(1-methylpyrrol-3-yl)methyl]oxan-4-amine.
| Compound Name | N-[(1-methylpyrrol-3-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 66397450 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-[(1-methylpyrrol-3-yl)methyl]oxan-4-amine |
| SMILES | Cn1ccc(CNC2CCOCC2)c1 |
| InChI | InChI=1S/C11H18N2O/c1-13-5-2-10(9-13)8-12-11-3-6-14-7-4-11/h2,5,9,11-12H,3-4,6-8H2,1H3 |
| InChIKey | IXZMTFJLCRYAJA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |