About [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol
[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol (PubChem CID 66397852) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol |
| PubChem CID | 66397852 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol |
| SMILES | Cc1noc(C)c1Cn1ccc(CO)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-8-11(9(2)15-12-8)6-13-4-3-10(5-13)7-14/h3-5,14H,6-7H2,1-2H3 |
| InChIKey | RSDRNCJZYFLCHV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol?
The IUPAC name of [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol (CID 66397852) is [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol.
What is the SMILES notation for [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol?
The canonical SMILES for [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol is Cc1noc(C)c1Cn1ccc(CO)c1.
What is the InChIKey of [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol?
The InChIKey is RSDRNCJZYFLCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-8-11(9(2)15-12-8)6-13-4-3-10(5-13)7-14/h3-5,14H,6-7H2,1-2H3.
What are the key properties of [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol?
[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol has a molecular weight of 206.24 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrrol-3-yl]methanol is sourced from PubChem (CID 66397852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).