About [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol
[1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol (PubChem CID 66398057) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol |
| PubChem CID | 66398057 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol |
| SMILES | Cc1ncsc1CCn1ccc(CO)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-9-11(15-8-12-9)3-5-13-4-2-10(6-13)7-14/h2,4,6,8,14H,3,5,7H2,1H3 |
| InChIKey | DGNDQWCUBJIMQI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol?
The IUPAC name of [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol (CID 66398057) is [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol.
What is the SMILES notation for [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol?
The canonical SMILES for [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol is Cc1ncsc1CCn1ccc(CO)c1.
What is the InChIKey of [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol?
The InChIKey is DGNDQWCUBJIMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-9-11(15-8-12-9)3-5-13-4-2-10(6-13)7-14/h2,4,6,8,14H,3,5,7H2,1H3.
What are the key properties of [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol?
[1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol has a molecular weight of 222.31 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrrol-3-yl]methanol is sourced from PubChem (CID 66398057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).